Alluranpunainen Lähteet | Aiheesta muualla | NavigointivalikkoInfobox OKVirheellinen NIMI-arvoCurry red - Substance SummaryPhysical Properties: Allura red AC dye RN: 25956-17-6IPCS inchem: Alluranpunainen

AtsoväritPunainen


monoatsoväriE-koodikemiallinen kaavaallergioitaatsoväritYhdysvalloissa1980amaranttiamaitotuotteissavanukkaissakosmetiikassaEECFDA























Alluranpunainen
Allura Red AC Structural Formula V1.svg
Tunnisteet
CAS-numero
025956-17-6
IUPAC-nimi
Dinatrium 5-[(2-metoksi-5-metyyli-4-sulfanaattofenyyli)hydratsiiniylidiini]-
6-oksonaftaleeni-2-sulfonaatti
SMILES

CC1=CC(=C(C=C1S(=O)(=O)[O-])OC)NN=C2C3=C(C=CC2=O)C=C(C=C3)S(=O)(=O)[O-].


[Na+].[Na+][1]
Ominaisuudet
Kemiallinen kaava
C18H14N2Na2O8S2
Moolimassa
496,432 g/mol
Sulamispiste
> 300 °C
Liukoisuus
2,25·105[2]

Infobox OKVirheellinen NIMI-arvo

Alluranpunainen, (englanniksi allura red AC) on oranssinpunainen monoatsoväri, jonka E-koodi on E 129 ja kemiallinen kaava C18H14N2Na2O8S2. Se saattaa aiheuttaa allergioita vähemmän kuin muut atsovärit, mutta iho-oireiden riski voi olla tavanomainen. Alluranpunainen korvasi Yhdysvalloissa 1980-luvulla siellä kielletyksi tullutta amaranttia.


Alluranpunaista käytetään maitotuotteissa, vanukkaissa, makeisissa ja juomissa sekä lääkkeissä että kosmetiikassa. Se on ollut kielletty joissain EEC-maissa. Yhdysvaltain FDA sallii sen elintarvikekäyttöön, jossa sen tunnus on FD&C #40.



Lähteet |



  1. ↑ Curry red - Substance Summary NCBI. Viitattu 30. toukokuuta 2008.


  2. ↑ Physical Properties: Allura red AC dye RN: 25956-17-6 NLM. Viitattu 30. toukokuuta 2008.



Aiheesta muualla |



  • IPCS inchem: Alluranpunainen (engl.)

-

Popular posts from this blog

Marja Vauras Lähteet | Aiheesta muualla | NavigointivalikkoMarja Vauras Turun yliopiston tutkimusportaalissaInfobox OKSuomalaisen Tiedeakatemian varsinaiset jäsenetKasvatustieteiden tiedekunnan dekaanit ja muu johtoMarja VaurasKoulutusvienti on kestävyys- ja ketteryyslaji (2.5.2017)laajentamallaWorldCat Identities0000 0001 0855 9405n86069603utb201588738523620927

Image
Vuonna 1953 syntyneetSuomalaiset kasvatustieteilijätSuomalaiset professoritTurun yliopiston professorit 9. maaliskuuta1953TurkuTurun yliopistonSuomalaisen tiedeakatemian Marja Vauras Henkilötiedot Syntynyt 9. maaliskuuta 1953 (ikä 66) Turku Kansallisuus Suomi Ammatti kasvatustieteen professori Koulutus ja ura Instituutti Turun yliopisto Aiheesta muualla Marja Vauras Turun yliopiston tutkimusportaalissa Infobox OK Marja Merja Sinikka Vauras (s. 9. maaliskuuta 1953 Turku) on suomalainen filosofian tohtori, ja Turun yliopiston kasvatustieteen professori. [1] [2] Hän on toiminut myös Turun yliopiston Kasvatustieteellisen tiedekunnan dekaanina. [3] Suomalaisen tiedeakatemian jäsen Vauras on ollut vuodesta 2013. [2] Lähteet | ↑ Suomen professorit 1640–2007 , Professoriliitto, 2008 (ISBN  978-952-99281-1-8 ja 978-952-99281-2-5 , viitattu 7 huhtikuuta 2019 ) ↑ a b Suomalaisen Tiedeakatemian varsinaiset jäsenet pä...
Read more

Which is better: GPT or RelGAN for text generation?2019 Community Moderator ElectionWhat is the difference between TextGAN and LM for text generation?GANs (generative adversarial networks) possible for text as well?Generator loss not decreasing- text to image synthesisChoosing a right algorithm for template-based text generationHow should I format input and output for text generation with LSTMsGumbel Softmax vs Vanilla Softmax for GAN trainingWhich neural network to choose for classification from text/speech?NLP text autoencoder that generates text in poetic meterWhat is the interpretation of the expectation notation in the GAN formulation?What is the difference between TextGAN and LM for text generation?How to prepare the data for text generation task

Image
Neighboring nodes in the network Is it canonical bit space? Why do I get two different answers for this counting problem? Python: return float 1.0 as int 1 but float 1.5 as float 1.5 Drawing a Grid/Tikz image Why is it a bad idea to hire a hitman to eliminate most corrupt politicians? Why is this clock signal connected to a capacitor to gnd? Blender 2.8 I can't see vertices, edges or faces in edit mode How to say in German "enjoying home comforts" Is there an expression that means doing something right before you will need it rather than doing it in case you might need it? Can a virus destroy the BIOS of a modern computer? Saudi Arabia Transit Visa Why "Having chlorophyll without photosynthesis is actually very dangerous" and "like living with a bomb"? What is the word for reserving something for yourself before others do? Why do bosons tend to occupy the same state? Is the Joker left-handed? What method can I use to des...
Read more

Is this part of the description of the Archfey warlock's Misty Escape feature redundant?When is entropic ward considered “used”?How does the reaction timing work for Wrath of the Storm? Can it potentially prevent the damage from the triggering attack?Does the Dark Arts Archlich warlock patrons's Arcane Invisibility activate every time you cast a level 1+ spell?When attacking while invisible, when exactly does invisibility break?Can I cast Hellish Rebuke on my turn?Do I have to “pre-cast” a reaction spell in order for it to be triggered?What happens if a Player Misty Escapes into an Invisible CreatureCan a reaction interrupt multiattack?Does the Fiend-patron warlock's Hurl Through Hell feature dispel effects that require the target to be on the same plane as the caster?What are you allowed to do while using the Warlock's Eldritch Master feature?

Image
How to Reset Passwords on Multiple Websites Easily? How can a function with a hole (removable discontinuity) equal a function with no hole? What is the opposite of 'gravitas'? Return the Closest Prime Number Term for the "extreme-extension" version of a straw man fallacy? How to check is there any negative term in a large list? How does it work when somebody invests in my business? How do I rename a Linux host without needing to reboot for the rename to take effect? Avoiding estate tax by giving multiple gifts Purchasing a ticket for someone else in another country? Energy of the particles in the particle accelerator How can I get through very long and very dry, but also very useful technical documents when learning a new tool? How did Doctor Strange see the winning outcome in Avengers: Infinity War? How to create a 32-bit integer from eight (8) 4-bit integers? What can we do to stop prior company from asking us questions? How to be diplo...
Read more