Alluranpunainen Lähteet | Aiheesta muualla | NavigointivalikkoInfobox OKVirheellinen NIMI-arvoCurry red - Substance SummaryPhysical Properties: Allura red AC dye RN: 25956-17-6IPCS inchem: Alluranpunainen

AtsoväritPunainen


monoatsoväriE-koodikemiallinen kaavaallergioitaatsoväritYhdysvalloissa1980amaranttiamaitotuotteissavanukkaissakosmetiikassaEECFDA























Alluranpunainen
Allura Red AC Structural Formula V1.svg
Tunnisteet
CAS-numero
025956-17-6
IUPAC-nimi
Dinatrium 5-[(2-metoksi-5-metyyli-4-sulfanaattofenyyli)hydratsiiniylidiini]-
6-oksonaftaleeni-2-sulfonaatti
SMILES

CC1=CC(=C(C=C1S(=O)(=O)[O-])OC)NN=C2C3=C(C=CC2=O)C=C(C=C3)S(=O)(=O)[O-].


[Na+].[Na+][1]
Ominaisuudet
Kemiallinen kaava
C18H14N2Na2O8S2
Moolimassa
496,432 g/mol
Sulamispiste
> 300 °C
Liukoisuus
2,25·105[2]

Infobox OKVirheellinen NIMI-arvo

Alluranpunainen, (englanniksi allura red AC) on oranssinpunainen monoatsoväri, jonka E-koodi on E 129 ja kemiallinen kaava C18H14N2Na2O8S2. Se saattaa aiheuttaa allergioita vähemmän kuin muut atsovärit, mutta iho-oireiden riski voi olla tavanomainen. Alluranpunainen korvasi Yhdysvalloissa 1980-luvulla siellä kielletyksi tullutta amaranttia.


Alluranpunaista käytetään maitotuotteissa, vanukkaissa, makeisissa ja juomissa sekä lääkkeissä että kosmetiikassa. Se on ollut kielletty joissain EEC-maissa. Yhdysvaltain FDA sallii sen elintarvikekäyttöön, jossa sen tunnus on FD&C #40.



Lähteet |



  1. ↑ Curry red - Substance Summary NCBI. Viitattu 30. toukokuuta 2008.


  2. ↑ Physical Properties: Allura red AC dye RN: 25956-17-6 NLM. Viitattu 30. toukokuuta 2008.



Aiheesta muualla |



  • IPCS inchem: Alluranpunainen (engl.)

-

Popular posts from this blog

Marja Vauras Lähteet | Aiheesta muualla | NavigointivalikkoMarja Vauras Turun yliopiston tutkimusportaalissaInfobox OKSuomalaisen Tiedeakatemian varsinaiset jäsenetKasvatustieteiden tiedekunnan dekaanit ja muu johtoMarja VaurasKoulutusvienti on kestävyys- ja ketteryyslaji (2.5.2017)laajentamallaWorldCat Identities0000 0001 0855 9405n86069603utb201588738523620927

Image
Vuonna 1953 syntyneetSuomalaiset kasvatustieteilijätSuomalaiset professoritTurun yliopiston professorit 9. maaliskuuta1953TurkuTurun yliopistonSuomalaisen tiedeakatemian Marja Vauras Henkilötiedot Syntynyt 9. maaliskuuta 1953 (ikä 66) Turku Kansallisuus Suomi Ammatti kasvatustieteen professori Koulutus ja ura Instituutti Turun yliopisto Aiheesta muualla Marja Vauras Turun yliopiston tutkimusportaalissa Infobox OK Marja Merja Sinikka Vauras (s. 9. maaliskuuta 1953 Turku) on suomalainen filosofian tohtori, ja Turun yliopiston kasvatustieteen professori. [1] [2] Hän on toiminut myös Turun yliopiston Kasvatustieteellisen tiedekunnan dekaanina. [3] Suomalaisen tiedeakatemian jäsen Vauras on ollut vuodesta 2013. [2] Lähteet | ↑ Suomen professorit 1640–2007 , Professoriliitto, 2008 (ISBN  978-952-99281-1-8 ja 978-952-99281-2-5 , viitattu 7 huhtikuuta 2019 ) ↑ a b Suomalaisen Tiedeakatemian varsinaiset jäsenet pä...
Read more

Which is better: GPT or RelGAN for text generation?2019 Community Moderator ElectionWhat is the difference between TextGAN and LM for text generation?GANs (generative adversarial networks) possible for text as well?Generator loss not decreasing- text to image synthesisChoosing a right algorithm for template-based text generationHow should I format input and output for text generation with LSTMsGumbel Softmax vs Vanilla Softmax for GAN trainingWhich neural network to choose for classification from text/speech?NLP text autoencoder that generates text in poetic meterWhat is the interpretation of the expectation notation in the GAN formulation?What is the difference between TextGAN and LM for text generation?How to prepare the data for text generation task

Image
Neighboring nodes in the network Is it canonical bit space? Why do I get two different answers for this counting problem? Python: return float 1.0 as int 1 but float 1.5 as float 1.5 Drawing a Grid/Tikz image Why is it a bad idea to hire a hitman to eliminate most corrupt politicians? Why is this clock signal connected to a capacitor to gnd? Blender 2.8 I can't see vertices, edges or faces in edit mode How to say in German "enjoying home comforts" Is there an expression that means doing something right before you will need it rather than doing it in case you might need it? Can a virus destroy the BIOS of a modern computer? Saudi Arabia Transit Visa Why "Having chlorophyll without photosynthesis is actually very dangerous" and "like living with a bomb"? What is the word for reserving something for yourself before others do? Why do bosons tend to occupy the same state? Is the Joker left-handed? What method can I use to des...
Read more

Is flight data recorder erased after every flight?When are black boxes used?What protects the location beacon (pinger) of a flight data recorder?Is there anywhere I can pick up raw flight data recorder information?Who legally owns the Flight Data Recorder?Constructing flight recorder dataWhy are FDRs and CVRs still two separate physical devices?What are the data elements shown on the GE235 flight data recorder (FDR) plot?Are CVR and FDR reset after every flight?What is the format of data stored by a Flight Data Recorder?How much data is stored in the flight data recorder per hour in a typical flight of an A380?Is a smart flight data recorder possible?

Image
Why are prions in animal diets not destroyed by the digestive system? How to increase the size of the cursor in Lubuntu 19.04? As matter approaches a black hole, does it speed up? Why is B♯ higher than C♭ in 31-ET? Nominativ or Akkusativ What does this colon mean? It is not labeling, it is not ternary operator Didn't attend field-specific conferences during my PhD; how much of a disadvantage is it? Applying a GPO to local users except local administrators on Workgroup computers Why has the UK chosen to use Huawei infrastructure when Five Eyes allies haven't? Using column size much larger than necessary Can my company stop me from working overtime? Will 700 more planes a day fly because of the Heathrow expansion? How to use dependency injection and avoid temporal coupling? Point of the Dothraki's attack in GoT S8E3? How I can I roll a number of non-digital dice to get a random number between 1 and 150? Validation rule Scheduled Apex I need a d...
Read more